CAS 898750-71-5

Methanone, (2-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of a chlorophenyl group indicates that one of the aromatic rings is substituted with a chlorine atom, which can influence the compound's reactivity and physical properties. Additionally, the molecule features a morpholinylmethyl substituent, suggesting potential applications in medicinal chemistry due to the morpholine ring's ability to interact with biological targets. This compound may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. Its specific interactions and stability would depend on the electronic and steric effects of the substituents, as well as the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose environmental and health risks.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-17-8-4-3-7-16(17)18(21)15-6-2-1-5-14(15)13-20-9-11-22-12-10-20/h1-8H,9-13H2

InChI key: InChIKey=DPDLMHUVDAUGGY-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC=C2)C=CC=C1)N3CCOCC3

Synonyms:

• 2-Chloro-2′-morpholinomethyl benzophenone
• Methanone, (2-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

2-Chloro-2′-morpholinomethyl benzophenone

CAS: 898750-71-5

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F205140