CymitQuimica logo

CAS 898750-74-8

:

(2-fluorophenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (2-fluorophenyl)-[2-(morpholinomethyl)phenyl]methanone, with the CAS number 898750-74-8, is a synthetic organic compound characterized by its complex structure, which includes a fluorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential lipophilicity due to the presence of aromatic rings. The fluorine atom may influence its electronic properties, potentially enhancing its reactivity or biological activity. Morpholine, a cyclic amine, contributes to the compound's solubility and may impart specific pharmacological properties. The presence of a ketone functional group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways or as a precursor in the synthesis of more complex molecules. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H18FNO2
InChI:InChI=1/C18H18FNO2/c19-17-8-4-3-7-16(17)18(21)15-6-2-1-5-14(15)13-20-9-11-22-12-10-20/h1-8H,9-13H2
SMILES:c1ccc(c(c1)CN1CCOCC1)C(=O)c1ccccc1F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.