CAS 898750-76-0

3-(3-chloro-5-fluoro-phenyl)-1-(3,4-dimethylphenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(3,4-dimethylphenyl)propan-1-one, with the CAS number 898750-76-0, is a synthetic organic compound that belongs to the class of ketones. This compound features a propanone backbone substituted with a chloro and a fluoro group on one phenyl ring, and a dimethyl-substituted phenyl group on the other. Its molecular structure indicates potential for various chemical interactions, making it of interest in medicinal chemistry and material science. The presence of halogen atoms (chlorine and fluorine) often enhances the compound's biological activity and lipophilicity, which can influence its pharmacokinetic properties. Additionally, the dimethyl substitution may affect the steric and electronic properties of the molecule, potentially impacting its reactivity and interactions with biological targets. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including solubility, stability, and biological activity.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-3-5-14(7-12(11)2)17(20)6-4-13-8-15(18)10-16(19)9-13/h3,5,7-10H,4,6H2,1-2H3

SMILES: Cc1ccc(cc1C)C(=O)CCc1cc(cc(c1)F)Cl