CAS 898750-77-1
:Methanone, [2-(4-morpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-
Description:
Methanone, specifically the compound known as [2-(4-morpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]- (CAS 898750-77-1), is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of the rings features a morpholinylmethyl substituent, contributing to its potential biological activity, while the other ring contains a trifluoromethyl group, which is known to enhance lipophilicity and influence the compound's reactivity and stability. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. Additionally, the trifluoromethyl group may impart unique electronic properties, making it a subject of interest in various chemical research fields, including materials science and pharmaceuticals. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C19H18F3NO2
InChI:InChI=1S/C19H18F3NO2/c20-19(21,22)17-8-4-3-7-16(17)18(24)15-6-2-1-5-14(15)13-23-9-11-25-12-10-23/h1-8H,9-13H2
InChI key:InChIKey=QJODFOFNDJMZSN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=C(C(F)(F)F)C=CC=C3
Synonyms:- 2-Morpholinomethyl-2′-trifluoromethylbenzophenone
- [2-(4-Morpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]methanone
- Methanone, [2-(4-morpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.