CAS 898750-79-3

3-(3-chloro-5-fluoro-phenyl)-1-(3,5-dimethylphenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(3,5-dimethylphenyl)propan-1-one, identified by its CAS number 898750-79-3, is a synthetic organic compound that belongs to the class of ketones. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3,5-dimethylphenyl group. The presence of chlorine and fluorine atoms in the structure contributes to its potential biological activity and lipophilicity, which may influence its solubility and reactivity. The compound is likely to exhibit characteristics typical of ketones, such as a carbonyl functional group that can participate in various chemical reactions, including nucleophilic additions. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account due to the presence of halogenated substituents.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-5-12(2)7-14(6-11)17(20)4-3-13-8-15(18)10-16(19)9-13/h5-10H,3-4H2,1-2H3

SMILES: Cc1cc(C)cc(c1)C(=O)CCc1cc(cc(c1)F)Cl