CAS 898750-80-6
:[2-(morpholin-4-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone
Description:
The chemical substance known as [2-(morpholin-4-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone, with the CAS number 898750-80-6, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with a morpholine group and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The morpholine moiety contributes to its solubility in polar solvents, while the trifluoromethyl group can enhance lipophilicity and influence biological activity. The compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications, as the combination of these substituents can affect interactions with biological targets. Additionally, its unique structure may lead to interesting electronic properties, making it a candidate for further research in various fields, including drug development and materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C19H18F3NO2
InChI:InChI=1/C19H18F3NO2/c20-19(21,22)16-6-3-5-14(12-16)18(24)17-7-2-1-4-15(17)13-23-8-10-25-11-9-23/h1-7,12H,8-11,13H2
SMILES:c1ccc(c(c1)CN1CCOCC1)C(=O)c1cccc(c1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.