CAS 898750-82-8

1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-

Description:

1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-, also known by its CAS number 898750-82-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: one containing a bromine and fluorine atom, and the other containing a chlorine and fluorine atom. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. Additionally, the halogen atoms can enhance the compound's biological activity, making it of interest in medicinal chemistry and material science. The specific arrangement of substituents also suggests potential for diverse interactions in chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, which are common in the chemistry of halogenated compounds.

Formula: C₁₅H₁₀BrClF₂O

InChI: InChI=1S/C15H10BrClF2O/c16-13-3-2-10(7-14(13)19)15(20)4-1-9-5-11(17)8-12(18)6-9/h2-3,5-8H,1,4H2

InChI key: InChIKey=TWCKHWLVVDGDHV-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(F)=C(Br)C=C1)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 4′-Bromo-3-(3-chloro-5-fluorophenyl)-3′-fluoropropiophenone
• 1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-
• 1-(4-Bromo-3-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-1-propanone