CAS 898750-85-1

3-(3-chloro-5-fluoro-phenyl)-1-(4-chloro-3-fluoro-phenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(4-chloro-3-fluoro-phenyl)propan-1-one, with the CAS number 898750-85-1, is a synthetic organic compound characterized by its complex structure featuring multiple halogen substituents. This compound belongs to the class of ketones, specifically a substituted propanone, which indicates the presence of a carbonyl group (C=O) within its molecular framework. The presence of chlorine and fluorine atoms suggests that it may exhibit unique electronic properties and reactivity, potentially influencing its biological activity and interactions with other molecules. The chlorinated and fluorinated phenyl groups can enhance lipophilicity and may contribute to the compound's pharmacological profile, making it of interest in medicinal chemistry. Additionally, the compound's structural features may allow for various synthetic modifications, enabling the exploration of its derivatives for potential applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the intricate design often found in modern organic synthesis aimed at developing new functional materials or therapeutic agents.

Formula: C₁₅H₁₀Cl₂F₂O

InChI: InChI=1/C15H10Cl2F2O/c16-11-5-9(6-12(18)8-11)1-4-15(20)10-2-3-13(17)14(19)7-10/h2-3,5-8H,1,4H2

SMILES: C(CC(=O)c1ccc(c(c1)F)Cl)c1cc(cc(c1)F)Cl