CAS 898750-88-4

1-(3-chloro-4-fluoro-phenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one

Description:

1-(3-chloro-4-fluoro-phenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one, with the CAS number 898750-88-4, is an organic compound characterized by its complex structure featuring multiple halogen substituents on aromatic rings. This compound contains a propanone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The chlorinated and fluorinated phenyl groups can also affect the compound's electronic properties, stability, and interaction with biological targets. Typically, such compounds are studied for their potential use in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of halogens can impact the compound's solubility and volatility, which are important factors in its practical applications. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in various fields of chemical research.

Formula: C₁₅H₁₀Cl₂F₂O

InChI: InChI=1/C15H10Cl2F2O/c16-11-5-9(6-12(18)8-11)1-4-15(20)10-2-3-14(19)13(17)7-10/h2-3,5-8H,1,4H2

SMILES: C(CC(=O)c1ccc(c(c1)Cl)F)c1cc(cc(c1)F)Cl