CAS 898750-91-9

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-chlorophenyl)-

Description:

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-chlorophenyl)-, identified by CAS number 898750-91-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 2-chlorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique chemical properties, potentially influencing its reactivity, polarity, and biological activity. The compound is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which typically enhance molecular stability. Its solubility in organic solvents is expected to be higher than in water due to the hydrophobic nature of the aromatic groups. Additionally, the compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1S/C15H11Cl2FO/c16-11-7-10(8-12(18)9-11)5-6-15(19)13-3-1-2-4-14(13)17/h1-4,7-9H,5-6H2

InChI key: InChIKey=IPTZVHDANPCWJP-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC(F)=C1)(=O)C2=C(Cl)C=CC=C2

Synonyms:

• 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-chlorophenyl)-
• 2′-Chloro-3-(3-chloro-5-fluorophenyl)propiophenone