CAS 898750-92-0

Methanone, (3-chloro-5-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The morpholine moiety suggests that the compound may exhibit certain pharmacological properties, as morpholine derivatives are often explored in medicinal chemistry for their ability to interact with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular interactions may include hydrogen bonding and π-π stacking due to the aromatic systems. As with many synthetic compounds, safety and handling precautions are essential, as the presence of halogens can indicate potential toxicity or environmental concerns. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1S/C18H17ClFNO2/c19-15-9-14(10-16(20)11-15)18(22)17-4-2-1-3-13(17)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=ZPDQMGPOWCMREF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC(Cl)=CC(F)=C3

Synonyms:

• (3-Chloro-5-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (3-chloro-5-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-

3′-Chloro-5′-fluoro-2-morpholinomethyl benzophenone

CAS: 898750-92-0

Formula: C₁₈H₁₇ClFNO₂

Purity: 97.0%

Molecular weight: 333.79

Ref: 10-F205147