CAS 898750-95-3

Methanone, (4-chloro-2-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings indicates that it may exhibit unique electronic properties and potential reactivity. The morpholinylmethyl group suggests that the compound may possess biological activity, possibly interacting with biological targets due to the morpholine moiety, which is known for its role in medicinal chemistry. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure may confer specific pharmacological properties, making it of interest in drug development or as a research chemical. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can influence toxicity and environmental impact. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific applications.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1/C18H17ClFNO2/c19-14-5-6-16(17(20)11-14)18(22)15-4-2-1-3-13(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=RNUOPMAAPSXRMX-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(F)C=C(Cl)C=C2)C=CC=C1)N3CCOCC3

Synonyms:

• 4-Chloro-2-fluoro-2′-morpholinomethyl benzophenone
• (4-Chloro-2-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (4-chloro-2-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-

4-Chloro-2-fluoro-2′-morpholinomethyl benzophenone

CAS: 898750-95-3

Formula: C₁₈H₁₇ClFNO₂

Purity: 97.0%

Molecular weight: 333.79

Ref: 10-F205148