CAS 898750-97-5

3-(3-chloro-5-fluoro-phenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with CAS number 898750-97-5, is a synthetic organic compound characterized by its complex structure featuring multiple aromatic rings and halogen substituents. This compound typically exhibits a high degree of lipophilicity due to the presence of fluorine and chlorine atoms, which can influence its solubility and reactivity. The trifluoromethyl group is known for enhancing the biological activity of compounds, making it of interest in pharmaceutical research. Additionally, the presence of the ketone functional group contributes to its reactivity, allowing for potential participation in various chemical reactions, such as nucleophilic additions. The compound's unique combination of substituents may also impart specific electronic properties, affecting its interaction with biological targets. Overall, this compound is likely to be studied for its potential applications in medicinal chemistry and material science, particularly in the development of new therapeutic agents or functional materials.

Formula: C₁₆H₁₁ClF₄O

InChI: InChI=1/C16H11ClF4O/c17-11-7-10(8-12(18)9-11)5-6-15(22)13-3-1-2-4-14(13)16(19,20)21/h1-4,7-9H,5-6H2

SMILES: c1ccc(c(c1)C(=O)CCc1cc(cc(c1)F)Cl)C(F)(F)F