CAS 898751-01-4

Methanone, (2,4-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. Additionally, the compound features a morpholine moiety, a six-membered ring containing both nitrogen and oxygen, which is known for its ability to enhance solubility and biological interactions. This compound may exhibit properties typical of both ketones and aromatic compounds, such as potential reactivity in electrophilic substitution reactions. Its specific applications and biological activity would depend on its interaction with various biological targets, making it of interest in medicinal chemistry and drug development. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1S/C18H17Cl2NO2/c19-14-5-6-16(17(20)11-14)18(22)15-4-2-1-3-13(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=LLIBJFIRZAGIMF-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=C(Cl)C=C2)C=CC=C1)N3CCOCC3

Synonyms:

• Methanone, (2,4-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]-
• 2,4-Dichloro-2′-morpholinomethyl benzophenone

2,4-Dichloro-2′-morpholinomethyl benzophenone

CAS: 898751-01-4

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F205150