CAS 898751-04-7

3-(3-chloro-5-fluoro-phenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one, identified by its CAS number 898751-04-7, is a synthetic organic compound characterized by its complex structure featuring multiple aromatic rings and halogen substituents. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms suggests enhanced lipophilicity and potential biological activity, making it of interest in pharmaceutical research. Its molecular structure indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or reductions. Additionally, the compound's stability and solubility characteristics can be influenced by the substituents on the aromatic rings, which may affect its interactions in biological systems. Overall, this compound's unique combination of functional groups and substituents positions it as a candidate for further investigation in medicinal chemistry and material science.

Formula: C₁₆H₁₁ClF₄O

InChI: InChI=1/C16H11ClF4O/c17-13-7-10(8-14(18)9-13)1-6-15(22)11-2-4-12(5-3-11)16(19,20)21/h2-5,7-9H,1,6H2

SMILES: C(CC(=O)c1ccc(cc1)C(F)(F)F)c1cc(cc(c1)F)Cl