CAS 898751-05-8

(2,5-dichlorophenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:

(2,5-Dichlorophenyl)-[2-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898751-05-8, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the dichlorophenyl moiety may enhance lipophilicity, influencing its solubility and permeability in biological systems. The morpholine ring introduces a nitrogen atom, which can participate in hydrogen bonding and may affect the compound's interaction with biological targets. Such structural features suggest that this compound could possess pharmacological properties, making it of interest in medicinal chemistry. Additionally, its synthesis and stability under various conditions would be important for practical applications. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine atoms, which can impart toxicity and environmental concerns.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1/C18H17Cl2NO2/c19-14-5-6-17(20)16(11-14)18(22)15-4-2-1-3-13(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

SMILES: c1ccc(c(c1)CN1CCOCC1)C(=O)c1cc(ccc1Cl)Cl