CAS 898751-08-1
:1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-
Description:
1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-, also known by its CAS number 898751-08-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-bromo-2-fluorophenyl group and a 3-chloro-5-fluorophenyl group. The presence of halogen atoms (bromine, chlorine, and fluorine) in its structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The compound is likely to exhibit moderate polarity due to the electronegative halogens, which can influence its interactions in various chemical environments. Additionally, the presence of multiple aromatic rings may impart stability and influence its behavior in biological systems or as a potential pharmaceutical agent. Overall, this compound's specific characteristics, including its melting point, boiling point, and reactivity, would need to be determined through experimental data for precise applications and safety assessments.
Formula:C15H10BrClF2O
InChI:InChI=1S/C15H10BrClF2O/c16-10-2-3-13(14(19)7-10)15(20)4-1-9-5-11(17)8-12(18)6-9/h2-3,5-8H,1,4H2
InChI key:InChIKey=BYNHRSIXCPHHPU-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(F)C=C(Br)C=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 1-(4-Bromo-2-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-1-propanone
- 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.