CAS 898751-09-2

Methanone, (3,5-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that chlorine atoms are substituted at the 3 and 5 positions of the phenyl ring, contributing to its reactivity and potential biological activity. Additionally, the compound features a morpholinylmethyl substituent, which introduces a morpholine ring—a six-membered heterocyclic structure containing oxygen and nitrogen. This morpholine moiety can enhance solubility and influence the compound's pharmacological properties. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. The compound's specific interactions, stability, and reactivity would depend on its molecular conformation and the electronic effects of the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogen substituents, which can affect toxicity and environmental impact.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1/C18H17Cl2NO2/c19-15-9-14(10-16(20)11-15)18(22)17-4-2-1-3-13(17)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=OVKVGFNBNNDWPT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC(Cl)=CC(Cl)=C3

Synonyms:

• Methanone, (3,5-dichlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

3′,5′-Dichloro-2-morpholinomethyl benzophenone

CAS: 898751-09-2

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F205153