CAS 898751-12-7

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-

Description:

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-, also known by its CAS number 898751-12-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2-chloro-4-fluorophenyl group and a 3-chloro-5-fluorophenyl group. The presence of chlorine and fluorine atoms in the phenyl rings contributes to its unique chemical properties, including potential reactivity and stability. The compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, influencing its solubility in various solvents. Additionally, the presence of multiple halogens may impart biological activity, making it of interest in pharmaceutical research. Its synthesis and applications may be relevant in fields such as medicinal chemistry, agrochemicals, or materials science, although specific applications would depend on further research and development. Safety data and handling precautions should be considered due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₅H₁₀Cl₂F₂O

InChI: InChI=1S/C15H10Cl2F2O/c16-10-5-9(6-12(19)7-10)1-4-15(20)13-3-2-11(18)8-14(13)17/h2-3,5-8H,1,4H2

InChI key: InChIKey=TWJHTAVUYQPDSZ-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=C(F)C=C1)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 2′-Chloro-3-(3-chloro-5-fluorophenyl)-4′-fluoropropiophenone
• 1-(2-Chloro-4-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-1-propanone
• 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chloro-5-fluorophenyl)-