CymitQuimica logo

CAS 898751-16-1

:

1,3-bis(3-chloro-5-fluoro-phenyl)propan-1-one

Description:
1,3-bis(3-chloro-5-fluoro-phenyl)propan-1-one, identified by its CAS number 898751-16-1, is an organic compound characterized by its unique structure featuring a propanone backbone substituted with two 3-chloro-5-fluorophenyl groups. This compound typically exhibits a solid state at room temperature and is likely to be a crystalline substance. Its molecular structure suggests potential reactivity due to the presence of halogen substituents, which can influence its chemical behavior and interactions. The chlorine and fluorine atoms may impart specific electronic properties, enhancing its potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's lipophilicity may affect its solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and light. As with many halogenated compounds, it is essential to consider safety and environmental impact, as they may pose risks if not handled properly. Overall, 1,3-bis(3-chloro-5-fluoro-phenyl)propan-1-one represents a compound of interest in various chemical research fields.
Formula:C15H10Cl2F2O
InChI:InChI=1/C15H10Cl2F2O/c16-11-3-9(4-13(18)7-11)1-2-15(20)10-5-12(17)8-14(19)6-10/h3-8H,1-2H2
SMILES:C(CC(=O)c1cc(cc(c1)F)Cl)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.