CAS 898751-20-7

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(4-chloro-2-fluorophenyl)-

Description:

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(4-chloro-2-fluorophenyl)-, also known by its CAS number 898751-20-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 4-chloro-2-fluorophenyl group. The presence of chlorine and fluorine atoms in the phenyl rings contributes to its unique chemical properties, including potential reactivity and biological activity. The chlorinated and fluorinated aromatic rings may enhance lipophilicity and influence the compound's interactions in biological systems. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can improve efficacy or selectivity. As with many organic compounds, its physical properties, such as solubility, boiling point, and melting point, would depend on the specific interactions of its functional groups and overall molecular geometry.

Formula: C₁₅H₁₀Cl₂F₂O

InChI: InChI=1S/C15H10Cl2F2O/c16-10-2-3-13(14(19)8-10)15(20)4-1-9-5-11(17)7-12(18)6-9/h2-3,5-8H,1,4H2

InChI key: InChIKey=DIIOCGLBHBEFGC-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=C(Cl)C=C1)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(4-chloro-2-fluorophenyl)-
• 3-(3-Chloro-5-fluorophenyl)-1-(4-chloro-2-fluorophenyl)-1-propanone
• 4′-Chloro-3-(3-chloro-5-fluorophenyl)-2′-fluoropropiophenone