CAS 898751-24-1

3-(3-chloro-5-fluoro-phenyl)-1-(2,3-dichlorophenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(2,3-dichlorophenyl)propan-1-one is an organic compound characterized by its complex structure, which includes multiple halogen substituents and a ketone functional group. This compound features a propanone backbone, with a phenyl group substituted at both ends, one of which carries a chloro and a fluoro group, while the other has two chlorine atoms. The presence of these halogens typically influences the compound's reactivity, stability, and solubility, often enhancing its biological activity. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as halogenated compounds are frequently explored for their medicinal properties. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the steric and electronic effects of the halogen substituents. Overall, this compound exemplifies the diverse chemistry of halogenated organic molecules, which are significant in various chemical industries.

Formula: C₁₅H₁₀Cl₃FO

InChI: InChI=1/C15H10Cl3FO/c16-10-6-9(7-11(19)8-10)4-5-14(20)12-2-1-3-13(17)15(12)18/h1-3,6-8H,4-5H2

SMILES: c1cc(C(=O)CCc2cc(cc(c2)F)Cl)c(c(c1)Cl)Cl