CAS 898751-25-2

Methanone, [2-(4-morpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-

Description:

Methanone, [2-(4-morpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-, also known by its CAS number 898751-25-2, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. The presence of a morpholine ring suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The trifluorophenyl group enhances the compound's lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing trifluoromethyl groups. Additionally, the morpholine moiety may impart solubility in polar solvents, making it suitable for various chemical reactions and formulations. Overall, the unique combination of functional groups in this compound suggests potential utility in pharmaceutical applications, particularly in the development of novel therapeutic agents.

Formula: C₁₈H₁₆F₃NO₂

InChI: InChI=1S/C18H16F3NO2/c19-15-9-13(10-16(20)17(15)21)18(23)14-4-2-1-3-12(14)11-22-5-7-24-8-6-22/h1-4,9-10H,5-8,11H2

InChI key: InChIKey=VTQBEOFFPOIRHP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC(F)=C(F)C(F)=C3

Synonyms:

• [2-(4-Morpholinylmethyl)phenyl](3,4,5-trifluorophenyl)methanone
• Methanone, [2-(4-morpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-
• 2-Morpholinomethyl-3′,4′,5′-trifluorobenzophenone