CAS 898751-28-5

3-(3-chloro-5-fluoro-phenyl)-1-(2,4-dichlorophenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(2,4-dichlorophenyl)propan-1-one, with the CAS number 898751-28-5, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and halogen substituents. This compound features a propanone functional group, indicating the presence of a ketone, which contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may exhibit unique electronic properties due to the electron-withdrawing effects of the halogens, potentially impacting its interactions with biological targets. Additionally, the presence of multiple chlorinated phenyl groups may confer stability and alter its solubility characteristics. Overall, this compound's distinctive features make it a subject of interest in various fields, including medicinal chemistry and materials science, where its properties can be exploited for specific applications.

Formula: C₁₅H₁₀Cl₃FO

InChI: InChI=1/C15H10Cl3FO/c16-10-2-3-13(14(18)8-10)15(20)4-1-9-5-11(17)7-12(19)6-9/h2-3,5-8H,1,4H2

SMILES: C(CC(=O)c1ccc(cc1Cl)Cl)c1cc(cc(c1)F)Cl