CAS 898751-29-6

Cyclopropyl[2-(4-morpholinylmethyl)phenyl]methanone

Description:

Cyclopropyl[2-(4-morpholinylmethyl)phenyl]methanone is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a phenyl ring substituted with a morpholinylmethyl group. This compound typically exhibits properties associated with both cyclic and aromatic systems, such as potential reactivity due to the strain in the cyclopropyl ring and the electron-donating characteristics of the morpholine moiety. The presence of the ketone functional group (methanone) suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the morpholine ring can contribute to the compound's solubility and interaction with biological systems, making it of interest in medicinal chemistry. The compound's molecular weight, boiling point, and solubility characteristics would depend on its specific structural features and the presence of functional groups. Overall, Cyclopropyl[2-(4-morpholinylmethyl)phenyl]methanone represents a complex organic molecule with potential applications in pharmaceuticals and material science.

Formula: C₁₅H₁₉NO₂

InChI: InChI=1S/C15H19NO2/c17-15(12-5-6-12)14-4-2-1-3-13(14)11-16-7-9-18-10-8-16/h1-4,12H,5-11H2

InChI key: InChIKey=LNKVHSNWQRIMCU-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2CC2)C=CC=C1)N3CCOCC3

Synonyms:

• Methanone, cyclopropyl[2-(4-morpholinylmethyl)phenyl]-
• Cyclopropyl[2-(4-morpholinylmethyl)phenyl]methanone

Cyclopropyl 2-(morpholinomethyl)phenyl ketone

CAS: 898751-29-6

Formula: C₁₅H₁₉NO₂

Purity: 97.0%

Molecular weight: 245.322

Ref: 10-F205158