CymitQuimica logo

CAS 898751-32-1

:

3-(3-chloro-5-fluoro-phenyl)-1-(2,5-dichlorophenyl)propan-1-one

Description:
3-(3-chloro-5-fluoro-phenyl)-1-(2,5-dichlorophenyl)propan-1-one, with the CAS number 898751-32-1, is a synthetic organic compound characterized by its complex structure, which includes multiple halogen substituents on aromatic rings. This compound features a propanone functional group, indicating it is a ketone, which contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may exhibit unique electronic properties due to the electron-withdrawing effects of the halogens, potentially affecting its interactions with biological targets. Additionally, the presence of multiple aromatic rings may contribute to its stability and solubility characteristics. Overall, this compound's unique combination of functional groups and substituents positions it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C15H10Cl3FO
InChI:InChI=1/C15H10Cl3FO/c16-10-2-3-14(18)13(8-10)15(20)4-1-9-5-11(17)7-12(19)6-9/h2-3,5-8H,1,4H2
SMILES:C(CC(=O)c1cc(ccc1Cl)Cl)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.