CAS 898751-36-5

3-(3-chloro-5-fluoro-phenyl)-1-(3,4-dichlorophenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(3,4-dichlorophenyl)propan-1-one, with the CAS number 898751-36-5, is a synthetic organic compound characterized by its complex structure, which includes multiple halogen substituents on aromatic rings. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms suggests that it may possess unique electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. Such halogenated compounds are often studied for their pharmacological activities, including potential use in medicinal chemistry. Additionally, the compound's molecular structure may impart specific physical properties, such as solubility and melting point, which are important for its application in various fields, including pharmaceuticals and agrochemicals. Overall, the characteristics of this compound make it a subject of interest for further research and development in chemical applications.

Formula: C₁₅H₁₀Cl₃FO

InChI: InChI=1/C15H10Cl3FO/c16-11-5-9(6-12(19)8-11)1-4-15(20)10-2-3-13(17)14(18)7-10/h2-3,5-8H,1,4H2

SMILES: C(CC(=O)c1ccc(c(c1)Cl)Cl)c1cc(cc(c1)F)Cl