CAS 898751-44-5
:1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2,4-difluorophenyl)-
Description:
1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2,4-difluorophenyl)-, with CAS number 898751-44-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with two distinct aromatic rings: one containing a chlorine and a fluorine atom, and the other containing two fluorine atoms. The presence of these halogen substituents can significantly influence the compound's chemical reactivity, polarity, and overall stability. Typically, such compounds exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in various solvents. Additionally, the presence of halogens may impart unique biological activities, making this compound of interest in medicinal chemistry and material science. Its synthesis and applications would likely involve considerations of its reactivity and interactions with other chemical species, particularly in the context of drug development or as a precursor in organic synthesis.
Formula:C15H10ClF3O
InChI:InChI=1S/C15H10ClF3O/c16-10-5-9(6-12(18)7-10)1-4-15(20)13-3-2-11(17)8-14(13)19/h2-3,5-8H,1,4H2
InChI key:InChIKey=LIFKNSSWQWTUNJ-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(F)C=C(F)C=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 3-(3-Chloro-5-fluorophenyl)-2′,4′-difluoropropiophenone
- 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.