CAS 898751-48-9
:1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4-difluorophenyl)-
Description:
1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4-difluorophenyl)-, also known by its CAS number 898751-48-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3,4-difluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its unique chemical properties, including potential reactivity and biological activity. The molecular structure suggests that it may exhibit significant lipophilicity due to the aromatic rings, which can influence its solubility and interaction with biological systems. Additionally, the presence of multiple fluorine atoms may enhance its stability and alter its electronic properties. This compound may be of interest in pharmaceutical research or materials science, where such substituted ketones can serve as intermediates or active pharmaceutical ingredients. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C15H10ClF3O
InChI:InChI=1S/C15H10ClF3O/c16-11-5-9(6-12(17)8-11)1-4-15(20)10-2-3-13(18)14(19)7-10/h2-3,5-8H,1,4H2
InChI key:InChIKey=UHFCZAWIKZOAHT-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=C(F)C=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4-difluorophenyl)-
- 3-(3-Chloro-5-fluorophenyl)-1-(3,4-difluorophenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.