CAS 898751-49-0: Ethyl 2-(4-morpholinylmethyl)-δ-oxobenzenepentanoate
Description:Ethyl 2-(4-morpholinylmethyl)-δ-oxobenzenepentanoate, identified by its CAS number 898751-49-0, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a morpholine moiety. This compound typically exhibits properties associated with both esters and heterocyclic amines, suggesting potential solubility in organic solvents and moderate polarity. The presence of the morpholine ring may impart unique pharmacological properties, making it of interest in medicinal chemistry. Ethyl 2-(4-morpholinylmethyl)-δ-oxobenzenepentanoate may also demonstrate biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. Its synthesis likely involves multi-step organic reactions, and it may be utilized in research related to drug development or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C18H25NO4
InChI:InChI=1S/C18H25NO4/c1-2-23-18(21)9-5-8-17(20)16-7-4-3-6-15(16)14-19-10-12-22-13-11-19/h3-4,6-7H,2,5,8-14H2,1H3
InChI key:InChIKey=MXPQEMYXPYNTAE-UHFFFAOYSA-N
SMILES:O=C(OCC)CCCC(=O)C=1C=CC=CC1CN2CCOCC2
- Synonyms:
- Benzenepentanoic acid, 2-(4-morpholinylmethyl)-δ-oxo-, ethyl ester
- Ethyl 2-(4-morpholinylmethyl)-δ-oxobenzenepentanoate
