CymitQuimica logo

CAS 898751-52-5

:

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,5-difluorophenyl)-

Description:
1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,5-difluorophenyl)-, also known by its CAS number 898751-52-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3,5-difluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its chemical reactivity and potential biological activity. The molecular structure suggests that it may exhibit interesting properties such as lipophilicity and potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and solubility can be influenced by the substituents on the aromatic rings. Overall, this compound's unique combination of functional groups and substituents positions it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C15H10ClF3O
InChI:InChI=1S/C15H10ClF3O/c16-11-3-9(4-12(17)7-11)1-2-15(20)10-5-13(18)8-14(19)6-10/h3-8H,1-2H2
InChI key:InChIKey=FZDPXZQWBKCMJH-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC(F)=C1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:
  • 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,5-difluorophenyl)-
  • 3-(3-Chloro-5-fluorophenyl)-3′,5′-difluoropropiophenone
  • 3-(3-Chloro-5-fluorophenyl)-1-(3,5-difluorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.