CAS 898751-54-7
:ethyl 7-(m-tolyl)-7-oxo-heptanoate
Description:
Ethyl 7-(m-tolyl)-7-oxo-heptanoate, identified by its CAS number 898751-54-7, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a heptanoate backbone, which consists of a seven-carbon chain, with a ketone group located at the seventh carbon. The presence of the m-tolyl group, a methyl-substituted phenyl ring, contributes to its aromatic characteristics and may influence its reactivity and solubility. Ethyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance applications. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions of the functional groups and the overall molecular structure. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C16H22O3
InChI:InChI=1/C16H22O3/c1-3-19-16(18)11-6-4-5-10-15(17)14-9-7-8-13(2)12-14/h7-9,12H,3-6,10-11H2,1-2H3
SMILES:CCOC(=O)CCCCCC(=O)c1cccc(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.