CymitQuimica logo

CAS 898751-56-9

:

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)-

Description:
1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)-, also known by its CAS number 898751-56-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3,4,5-trifluorophenyl group. The presence of multiple fluorine and chlorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound is likely to exhibit stability under standard conditions, but its reactivity may be influenced by the electronegative halogen substituents. Such characteristics make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C15H9ClF4O
InChI:InChI=1/C15H9ClF4O/c16-10-3-8(4-11(17)7-10)1-2-14(21)9-5-12(18)15(20)13(19)6-9/h3-7H,1-2H2
InChI key:InChIKey=GCUOTOUHRPWTJS-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC(F)=C1)(=O)C2=CC(F)=C(F)C(F)=C2
Synonyms:
  • 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)-
  • 3-(3-Chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.