CAS 898751-57-0

Ethyl 2-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate

Description:

Ethyl 2-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate, identified by its CAS number 898751-57-0, is a chemical compound that features a complex structure incorporating both an ester and a morpholine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. Its molecular structure suggests it may possess moderate solubility in organic solvents, while its solubility in water could be limited due to the presence of the hydrophobic aromatic and aliphatic components. The morpholine group may impart certain biological activities, potentially making this compound of interest in pharmaceutical applications. Additionally, the presence of the oxobenzene and heptanoate components may influence its reactivity and stability under various conditions. As with many organic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and materials science.

Formula: C₂₀H₂₉NO₄

InChI: InChI=1S/C20H29NO4/c1-2-25-20(23)11-5-3-4-10-19(22)18-9-7-6-8-17(18)16-21-12-14-24-15-13-21/h6-9H,2-5,10-16H2,1H3

InChI key: InChIKey=HTVJKJWSBRYIJU-UHFFFAOYSA-N

SMILES: C(CCCCCC(OCC)=O)(=O)C1=C(CN2CCOCC2)C=CC=C1

Synonyms:

• Ethyl 2-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate
• Benzeneheptanoic acid, 2-(4-morpholinylmethyl)-ζ-oxo-, ethyl ester