CAS 898751-64-9
:3-(3-Chloro-5-fluorophenyl)-1-cyclopropyl-1-propanone
Description:
3-(3-Chloro-5-fluorophenyl)-1-cyclopropyl-1-propanone, identified by its CAS number 898751-64-9, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropyl group, which contributes to its rigidity and potential reactivity, and a propanone functional group, indicating the presence of a ketone. The compound also features a chlorinated and fluorinated phenyl ring, which can influence its electronic properties and biological activity. The presence of halogens, such as chlorine and fluorine, often enhances lipophilicity and can affect the compound's pharmacokinetics and pharmacodynamics. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific characteristics, such as melting point, boiling point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in various applications, including drug development and chemical research.
Formula:C12H12ClFO
InChI:InChI=1S/C12H12ClFO/c13-10-5-8(6-11(14)7-10)1-4-12(15)9-2-3-9/h5-7,9H,1-4H2
InChI key:InChIKey=RXMINXQCTGGKML-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC(F)=C1)(=O)C2CC2
Synonyms:- 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-cyclopropyl-
- 3-(3-Chloro-5-fluorophenyl)-1-cyclopropyl-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.