CAS 898751-67-2
:3-(3-chloro-5-fluoro-phenyl)-1-cyclobutyl-propan-1-one
Description:
3-(3-Chloro-5-fluoro-phenyl)-1-cyclobutyl-propan-1-one, with the CAS number 898751-67-2, is a synthetic organic compound characterized by its unique structural features. It contains a cyclobutyl group, which contributes to its three-dimensional conformation, and a propanone functional group, indicating the presence of a ketone. The compound also features a phenyl ring substituted with both a chlorine and a fluorine atom, which can influence its reactivity and biological activity. The presence of these halogen substituents often enhances lipophilicity and can affect the compound's interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many synthetic organic compounds, its physical properties, such as solubility, melting point, and stability, would depend on the specific conditions under which it is studied.
Formula:C13H14ClFO
InChI:InChI=1/C13H14ClFO/c14-11-6-9(7-12(15)8-11)4-5-13(16)10-2-1-3-10/h6-8,10H,1-5H2
SMILES:C1CC(C1)C(=O)CCc1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.