CAS 898751-68-3

m-tolyl-[2-(1-piperidylmethyl)phenyl]methanone

Description:

m-Tolyl-[2-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898751-68-3, is a chemical compound that belongs to the class of ketones. It features a ketone functional group, characterized by a carbonyl group (C=O) bonded to two aromatic rings, specifically a tolyl group and a phenyl group. The presence of a piperidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit various biological activities due to its structural components, which can influence its interaction with biological targets. Its molecular structure suggests it may possess lipophilic properties, allowing it to traverse biological membranes. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings and the piperidine nitrogen. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further research and analysis.

Formula: C₂₀H₂₃NO

InChI: InChI=1/C20H23NO/c1-16-8-7-10-17(14-16)20(22)19-11-4-3-9-18(19)15-21-12-5-2-6-13-21/h3-4,7-11,14H,2,5-6,12-13,15H2,1H3

SMILES: Cc1cccc(c1)C(=O)c1ccccc1CN1CCCCC1

3′-Methyl-2-piperidinomethyl benzophenone

CAS: 898751-68-3

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F205168