CymitQuimica logo

CAS 898751-70-7

:

3-(3-chloro-5-fluoro-phenyl)-1-cyclopentyl-propan-1-one

Description:
3-(3-Chloro-5-fluoro-phenyl)-1-cyclopentyl-propan-1-one, with the CAS number 898751-70-7, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclopentyl group and a propanone moiety. This compound features a phenyl ring substituted with both chlorine and fluorine atoms, contributing to its potential biological activity and chemical reactivity. The presence of halogens often influences the compound's lipophilicity and can affect its interactions with biological targets. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential use as pharmaceuticals or agrochemicals. The cyclopentyl group can enhance the compound's steric properties, potentially influencing its binding affinity in biological systems. Additionally, the compound's stability, solubility, and reactivity can be affected by the functional groups present, making it of interest for further research in various chemical and pharmaceutical applications. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C14H16ClFO
InChI:InChI=1/C14H16ClFO/c15-12-7-10(8-13(16)9-12)5-6-14(17)11-3-1-2-4-11/h7-9,11H,1-6H2
SMILES:C1CCC(C1)C(=O)CCc1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.