CAS 898751-71-8

Methanone, (4-methylphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. This compound features a 4-methylphenyl group and a 2-(1-piperidinylmethyl)phenyl group, indicating that it has both hydrophobic and polar characteristics, which may influence its solubility and interaction with biological systems. The molecular structure implies that it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, depending on the conditions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the substituents on the aromatic rings and the piperidine ring. Overall, Methanone, (4-methylphenyl)[2-(1-piperidinylmethyl)phenyl]- is a compound of interest in medicinal chemistry, potentially serving as a lead compound for drug development or as a research tool in studying biological pathways.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-16-9-11-17(12-10-16)20(22)19-8-4-3-7-18(19)15-21-13-5-2-6-14-21/h3-4,7-12H,2,5-6,13-15H2,1H3

InChI key: InChIKey=UXRHTBIEVGTUQY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• 4′-Methyl-2-piperidinomethyl benzophenone
• Methanone, (4-methylphenyl)[2-(1-piperidinylmethyl)phenyl]-

4′-Methyl-2-piperidinomethyl benzophenone

CAS: 898751-71-8

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F205169