CAS 898751-74-1

Methanone, (2-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of a methoxy group (-OCH3) on one of the phenyl rings enhances its solubility and reactivity, while the piperidinylmethyl substituent introduces a nitrogen-containing heterocycle, which can influence the compound's biological activity and pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular interactions are likely influenced by hydrogen bonding and π-π stacking due to the aromatic systems. Additionally, the presence of the piperidine moiety may impart certain characteristics such as potential neuroactivity, making it of interest in medicinal chemistry. As with many organic compounds, its behavior in various solvents and under different conditions can vary, impacting its applications in research and industry.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-23-19-12-6-5-11-18(19)20(22)17-10-4-3-9-16(17)15-21-13-7-2-8-14-21/h3-6,9-12H,2,7-8,13-15H2,1H3

InChI key: InChIKey=MLFQOWCXNRAXPV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=C(OC)C=CC=C3

Synonyms:

• Methanone, (2-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]-
• 2-Methoxy-2′-piperidinomethyl benzophenone
• (2-Methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]methanone