CAS 898751-75-2
:ethyl 6-(3,5-dimethylphenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(3,5-dimethylphenyl)-6-oxo-hexanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a hexanoate backbone, indicating a six-carbon chain, with a ketone group (6-oxo) and a substituted aromatic ring (3,5-dimethylphenyl) at the sixth carbon position. The presence of the ethyl group suggests that it is an ethyl ester, contributing to its solubility in organic solvents. The 3,5-dimethyl substitution on the phenyl ring enhances its hydrophobic character and may influence its reactivity and interaction with biological systems. Ethyl 6-(3,5-dimethylphenyl)-6-oxo-hexanoate may exhibit interesting properties such as potential biological activity, making it of interest in fields like medicinal chemistry or materials science. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and reactivity under various conditions.
Formula:C16H22O3
InChI:InChI=1/C16H22O3/c1-4-19-16(18)8-6-5-7-15(17)14-10-12(2)9-13(3)11-14/h9-11H,4-8H2,1-3H3
SMILES:CCOC(=O)CCCCC(=O)c1cc(C)cc(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.