CAS 898751-80-9

Methanone, (4-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The methoxy group on one of the phenyl rings enhances the compound's lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound may exhibit various chemical properties, including reactivity due to the carbonyl group, which can participate in nucleophilic addition reactions. Additionally, the overall molecular structure may contribute to its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). While specific data on its physical properties like melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high stability under standard conditions. Further studies would be necessary to elucidate its specific applications and biological effects.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-23-18-11-9-16(10-12-18)20(22)19-8-4-3-7-17(19)15-21-13-5-2-6-14-21/h3-4,7-12H,2,5-6,13-15H2,1H3

InChI key: InChIKey=WMYSBEOHMMQEOE-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC=C(OC)C=C2)C=CC=C1)N3CCCCC3

Synonyms:

• (4-Methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (4-methoxyphenyl)[2-(1-piperidinylmethyl)phenyl]-
• 4′-Methoxy-2-piperidinomethyl benzophenone

4′-Methoxy-2-piperidinomethyl benzophenone

CAS: 898751-80-9

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F205172