CAS 898751-89-8

4-[2-(1-Piperidinylmethyl)benzoyl]benzonitrile

Description:

4-[2-(1-Piperidinylmethyl)benzoyl]benzonitrile, with the CAS number 898751-89-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of the piperidine group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the nitrile functional group may impart unique reactivity and stability characteristics. As with many compounds containing nitrogen, it may exhibit basic properties, influencing its behavior in various chemical environments. Overall, this compound's structural features suggest it could be investigated for applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical and chemical properties would need to be determined through experimental methods for precise characterization.

Formula: C₂₀H₂₀N₂O

InChI: InChI=1S/C20H20N2O/c21-14-16-8-10-17(11-9-16)20(23)19-7-3-2-6-18(19)15-22-12-4-1-5-13-22/h2-3,6-11H,1,4-5,12-13,15H2

InChI key: InChIKey=PJGYRYSKLNLHHH-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC=C(C#N)C=C2)C=CC=C1)N3CCCCC3

Synonyms:

• 4-[2-(1-Piperidinylmethyl)benzoyl]benzonitrile
• Benzonitrile, 4-[2-(1-piperidinylmethyl)benzoyl]-

4′-Cyano-2-piperidinomethyl benzophenone

CAS: 898751-89-8

Formula: C₂₀H₂₀N₂O

Purity: 97.0%

Molecular weight: 304.393

Ref: 10-F205175