CAS 898752-01-7

Methanone, [2-(methylthio)phenyl][2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, [2-(methylthio)phenyl][2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings, one of which is substituted with a methylthio group and the other with a piperidinylmethyl group. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule due to the presence of the carbonyl group, which can engage in hydrogen bonding. The presence of the piperidine ring suggests potential for biological activity, as piperidine derivatives are often found in pharmaceuticals. Additionally, the methylthio group can influence the compound's reactivity and solubility. The molecular interactions and potential applications of this compound may be explored in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-23-19-12-6-5-11-18(19)20(22)17-10-4-3-9-16(17)15-21-13-7-2-8-14-21/h3-6,9-12H,2,7-8,13-15H2,1H3

InChI key: InChIKey=KQHOQRMGDYFTHD-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=C(SC)C=CC=C3

Synonyms:

• Methanone, [2-(methylthio)phenyl][2-(1-piperidinylmethyl)phenyl]-
• [2-(Methylsulfanyl)phenyl][2-(1-piperidinylmethyl)phenyl]methanone

2-Piperidinomethyl-2′-thiomethylbenzophenone

CAS: 898752-01-7

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F205179