CAS 898752-12-0
:ethyl 6-(3-fluorophenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(3-fluorophenyl)-6-oxo-hexanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a hexanoate backbone, indicating a six-carbon chain, with a ketone group (6-oxo) at the sixth position and a 3-fluorophenyl substituent at the same carbon. The presence of the fluorine atom on the phenyl ring can influence the compound's reactivity and physical properties, such as polarity and solubility. Ethyl 6-(3-fluorophenyl)-6-oxo-hexanoate may exhibit interesting biological activities, making it a potential candidate for pharmaceutical applications. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's stability, solubility in organic solvents, and potential for further derivatization are important characteristics that can be explored in synthetic chemistry and medicinal chemistry contexts.
Formula:C14H17FO3
InChI:InChI=1/C14H17FO3/c1-2-18-14(17)9-4-3-8-13(16)11-6-5-7-12(15)10-11/h5-7,10H,2-4,8-9H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.