CAS 898752-20-0
:ethyl 8-(3-chlorophenyl)-8-oxo-octanoate
Description:
Ethyl 8-(3-chlorophenyl)-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a long carbon chain, specifically an octanoate backbone, which contributes to its hydrophobic properties. The presence of the 3-chlorophenyl group introduces a chlorine substituent on the aromatic ring, which can influence the compound's reactivity and biological activity. The ketone functional group (8-oxo) indicates that there is a carbonyl group (C=O) located at the eighth carbon of the octanoate chain, which can affect the compound's stability and reactivity. Ethyl 8-(3-chlorophenyl)-8-oxo-octanoate may exhibit various properties such as solubility in organic solvents, potential biological activity, and applications in pharmaceuticals or agrochemicals. Its specific characteristics, including melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C16H21ClO3
InChI:InChI=1/C16H21ClO3/c1-2-20-16(19)11-6-4-3-5-10-15(18)13-8-7-9-14(17)12-13/h7-9,12H,2-6,10-11H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.