CAS 898752-22-2
:ethyl 4-(3,4-difluorophenyl)-4-oxo-butanoate
Description:
Ethyl 4-(3,4-difluorophenyl)-4-oxo-butanoate, identified by its CAS number 898752-22-2, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a butanoate backbone, where the ethyl group is attached to the carboxylic acid part, contributing to its ester classification. The presence of the 3,4-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can influence its chemical reactivity and physical properties, such as polarity and solubility. The fluorine substituents often enhance the compound's lipophilicity and can affect its biological activity. Ethyl 4-(3,4-difluorophenyl)-4-oxo-butanoate may exhibit interesting properties in terms of its reactivity, making it potentially useful in various synthetic applications, including pharmaceuticals and agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on the purity and specific conditions of the substance.
Formula:C12H12F2O3
InChI:InChI=1/C12H12F2O3/c1-2-17-12(16)6-5-11(15)8-3-4-9(13)10(14)7-8/h3-4,7H,2,5-6H2,1H3
SMILES:CCOC(=O)CCC(=O)c1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.