CAS 898752-24-4
:ethyl 5-(3,4-difluorophenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(3,4-difluorophenyl)-5-oxo-pentanoate is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. The presence of the 3,4-difluorophenyl group indicates that this molecule has two fluorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties, such as polarity and boiling point. The pentanoate portion of the molecule suggests a five-carbon chain with a ketone functionality, contributing to its overall structure and potential reactivity. This compound may exhibit interesting biological activity due to the presence of the difluorophenyl moiety, which is often associated with enhanced pharmacological properties. Additionally, the ethyl ester group can affect solubility and volatility, making it relevant in various chemical applications, including synthesis and medicinal chemistry. Overall, ethyl 5-(3,4-difluorophenyl)-5-oxo-pentanoate is a complex molecule with unique characteristics that may be explored for its potential uses in research and industry.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c1-2-18-13(17)5-3-4-12(16)9-6-7-10(14)11(15)8-9/h6-8H,2-5H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.