CAS 898752-82-4
:ethyl 7-(2-naphthyl)-7-oxo-heptanoate
Description:
Ethyl 7-(2-naphthyl)-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate backbone, indicating it has a seven-carbon chain, with a ketone group at the seventh position and a 2-naphthyl substituent, which contributes to its aromatic properties. The presence of the naphthyl group enhances the compound's hydrophobic characteristics and may influence its reactivity and solubility in organic solvents. Ethyl 7-(2-naphthyl)-7-oxo-heptanoate is likely to exhibit moderate to high lipophilicity, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. Its molecular structure suggests it may participate in reactions typical of esters, such as hydrolysis or transesterification. Additionally, the compound's unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various chemical and industrial fields.
Formula:C19H22O3
InChI:InChI=1/C19H22O3/c1-2-22-19(21)11-5-3-4-10-18(20)17-13-12-15-8-6-7-9-16(15)14-17/h6-9,12-14H,2-5,10-11H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccc2ccccc2c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.