Product correctly added to cart.

ethyl 5-oxo-5-(9-phenanthryl)pentanoate

CAS 898752-88-0: ethyl 5-oxo-5-(9-phenanthryl)pentanoate

Description:Ethyl 5-oxo-5-(9-phenanthryl)pentanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a phenanthryl group, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of the 5-oxo group indicates that it contains a ketone functionality, which can participate in various chemical reactions, such as nucleophilic additions. The ethyl ester portion of the molecule suggests that it may exhibit moderate volatility and solubility in organic solvents. Its structure implies potential applications in organic synthesis, possibly as an intermediate in the production of more complex molecules or in medicinal chemistry. Additionally, the unique combination of functional groups may impart specific biological activities, making it a candidate for further investigation in pharmacological studies. Overall, ethyl 5-oxo-5-(9-phenanthryl)pentanoate is a compound of interest due to its structural features and potential applications in various fields of chemistry.

Formula:C21H20O3

InChI:InChI=1/C21H20O3/c1-2-24-21(23)13-7-12-20(22)19-14-15-8-3-4-9-16(15)17-10-5-6-11-18(17)19/h3-6,8-11,14H,2,7,12-13H2,1H3

Sort by


See more categories

This search does not contain any category.

Found 1 products.

BrandProduct dataPurityPrice rangeEstimated delivery
Biosynth logo
Ethyl 5-oxo-5-(9-phenanthryl)valerate
REF: 3D-YKB75288
CAS: 898752-88-0
Min. 95%- - -Discontinued product
discount label

Ethyl 5-oxo-5-(9-phenanthryl)valerate

CAS:898752-88-0

Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".